C20H24N8O2S — CID 30760065
3,7-dimethyl-1-[3-[(4-propyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]purine-2,6-dione (PubChem CID 30760065) has the molecular formula C20H24N8O2S and a molecular weight of 440.53 g/mol. Its IUPAC name is 3,7-dimethyl-1-[3-[(4-propyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[3-[(4-propyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 30760065 |
| Molecular Formula | C20H24N8O2S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3,7-dimethyl-1-[3-[(4-propyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]purine-2,6-dione |
| SMILES | CCCn1c(SCCCn2c(=O)c3c(ncn3C)n(C)c2=O)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H24N8O2S/c1-4-10-27-16(14-6-8-21-9-7-14)23-24-19(27)31-12-5-11-28-18(29)15-17(22-13-25(15)2)26(3)20(28)30/h6-9,13H,4-5,10-12H2,1-3H3 |
| InChIKey | HCHKEGGJXIVBFA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 105.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|