C24H22ClN7O2S — CID 4838281
1-[3-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 4838281) has the molecular formula C24H22ClN7O2S and a molecular weight of 508.01 g/mol. Its IUPAC name is 1-[3-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[3-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4838281 |
| Molecular Formula | C24H22ClN7O2S |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 1-[3-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCSc1nnc(-c3ccccc3)n1-c1ccc(Cl)cc1)c(=O)n2C |
| InChI | InChI=1S/C24H22ClN7O2S/c1-29-15-26-21-19(29)22(33)31(24(34)30(21)2)13-6-14-35-23-28-27-20(16-7-4-3-5-8-16)32(23)18-11-9-17(25)10-12-18/h3-5,7-12,15H,6,13-14H2,1-2H3 |
| InChIKey | LJSBWURRNNKYTN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|