C19H17F3N6O2S — CID 30990672
3,7-dimethyl-1-[3-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropyl]purine-2,6-dione (PubChem CID 30990672) has the molecular formula C19H17F3N6O2S and a molecular weight of 450.45 g/mol. Its IUPAC name is 3,7-dimethyl-1-[3-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[3-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropyl]purine-2,6-dione |
|---|---|
| PubChem CID | 30990672 |
| Molecular Formula | C19H17F3N6O2S |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3,7-dimethyl-1-[3-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropyl]purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCSc1nc(C(F)(F)F)nc3ccccc13)c(=O)n2C |
| InChI | InChI=1S/C19H17F3N6O2S/c1-26-10-23-14-13(26)16(29)28(18(30)27(14)2)8-5-9-31-15-11-6-3-4-7-12(11)24-17(25-15)19(20,21)22/h3-4,6-7,10H,5,8-9H2,1-2H3 |
| InChIKey | CYGXBXWMLINUSY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|