C24H21FN6O3S — CID 112779507
1-[3-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 112779507) has the molecular formula C24H21FN6O3S and a molecular weight of 492.54 g/mol. Its IUPAC name is 1-[3-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[3-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 112779507 |
| Molecular Formula | C24H21FN6O3S |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-[3-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCSc1nc3ccccc3c(=O)n1-c1ccc(F)cc1)c(=O)n2C |
| InChI | InChI=1S/C24H21FN6O3S/c1-28-14-26-20-19(28)22(33)30(24(34)29(20)2)12-5-13-35-23-27-18-7-4-3-6-17(18)21(32)31(23)16-10-8-15(25)9-11-16/h3-4,6-11,14H,5,12-13H2,1-2H3 |
| InChIKey | RKYZDAXTIJAXML-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|