C20H22N6O2S2 — CID 112783289
3,7-dimethyl-1-[3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)propyl]purine-2,6-dione (PubChem CID 112783289) has the molecular formula C20H22N6O2S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 3,7-dimethyl-1-[3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)propyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 112783289 |
| Molecular Formula | C20H22N6O2S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3,7-dimethyl-1-[3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)propyl]purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCSc1ncnc3sc4c(c13)CCCC4)c(=O)n2C |
| InChI | InChI=1S/C20H22N6O2S2/c1-24-11-23-16-15(24)19(27)26(20(28)25(16)2)8-5-9-29-17-14-12-6-3-4-7-13(12)30-18(14)22-10-21-17/h10-11H,3-9H2,1-2H3 |
| InChIKey | MCGFULVZNXSSCW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|