C21H25N7O2S2 — CID 42988273
1-[3-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 42988273) has the molecular formula C21H25N7O2S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 1-[3-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[3-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 42988273 |
| Molecular Formula | C21H25N7O2S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1-[3-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | CC1CCc2c(sc3nc(SCCCn4c(=O)c5c(ncn5C)n(C)c4=O)nc(N)c23)C1 |
| InChI | InChI=1S/C21H25N7O2S2/c1-11-5-6-12-13(9-11)32-18-14(12)16(22)24-20(25-18)31-8-4-7-28-19(29)15-17(23-10-26(15)2)27(3)21(28)30/h10-11H,4-9H2,1-3H3,(H2,22,24,25) |
| InChIKey | KUVMOQNBAXNOKJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|