C21H21N5OS2 — CID 46805879
2-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 46805879) has the molecular formula C21H21N5OS2 and a molecular weight of 423.57 g/mol. Its IUPAC name is 2-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 46805879 |
| Molecular Formula | C21H21N5OS2 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)cc(CSc3nc(N)c4c5c(sc4n3)CC(C)CC5)nc12 |
| InChI | InChI=1S/C21H21N5OS2/c1-11-5-6-14-15(8-11)29-20-17(14)18(22)24-21(25-20)28-10-13-9-16(27)26-7-3-4-12(2)19(26)23-13/h3-4,7,9,11H,5-6,8,10H2,1-2H3,(H2,22,24,25) |
| InChIKey | ROYXGNUENNFHRN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |