C15H15N3OS3 — CID 46675156
4-methyl-3-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethyl]-1,3-thiazol-2-one (PubChem CID 46675156) has the molecular formula C15H15N3OS3 and a molecular weight of 349.51 g/mol. Its IUPAC name is 4-methyl-3-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethyl]-1,3-thiazol-2-one.
| Compound Name | 4-methyl-3-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 46675156 |
| Molecular Formula | C15H15N3OS3 |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 4-methyl-3-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethyl]-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1CCSc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C15H15N3OS3/c1-9-7-21-15(19)18(9)5-6-20-13-12-10-3-2-4-11(10)22-14(12)17-8-16-13/h7-8H,2-6H2,1H3 |
| InChIKey | ITOHPWVDOWNULE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |