C12H14N2O2S2 — CID 30764923
2-[[(2S)-oxan-2-yl]methylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 30764923) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[[(2S)-oxan-2-yl]methylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[(2S)-oxan-2-yl]methylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 30764923 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[[(2S)-oxan-2-yl]methylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(SC[C@@H]2CCCCO2)nc2sccc12 |
| InChI | InChI=1S/C12H14N2O2S2/c15-10-9-4-6-17-11(9)14-12(13-10)18-7-8-3-1-2-5-16-8/h4,6,8H,1-3,5,7H2,(H,13,14,15)/t8-/m0/s1 |
| InChIKey | MCZPJCIRBDUYOD-QMMMGPOBSA-N |
| XLogP | 2.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |