C10H17NO2S — CID 3076675
2-[2-(dimethylamino)ethoxy]-1-thiophen-2-ylethanol (PubChem CID 3076675) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]-1-thiophen-2-ylethanol.
| Compound Name | 2-[2-(dimethylamino)ethoxy]-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 3076675 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]-1-thiophen-2-ylethanol |
| SMILES | CN(C)CCOCC(O)c1cccs1 |
| InChI | InChI=1S/C10H17NO2S/c1-11(2)5-6-13-8-9(12)10-4-3-7-14-10/h3-4,7,9,12H,5-6,8H2,1-2H3 |
| InChIKey | CVGCSWKYYWNOCG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|