C14H26N4OS — CID 3076723
2-(dibutylamino)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 3076723) has the molecular formula C14H26N4OS and a molecular weight of 298.46 g/mol. Its IUPAC name is 2-(dibutylamino)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(dibutylamino)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3076723 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-(dibutylamino)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCN(CCCC)CC(=O)Nc1nnc(CC)s1 |
| InChI | InChI=1S/C14H26N4OS/c1-4-7-9-18(10-8-5-2)11-12(19)15-14-17-16-13(6-3)20-14/h4-11H2,1-3H3,(H,15,17,19) |
| InChIKey | IIEHOWGKHUGEHD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |