C8H4ClF3N2O — CID 30772169
5-chloro-6-methyl-2-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile (PubChem CID 30772169) has the molecular formula C8H4ClF3N2O and a molecular weight of 236.58 g/mol. Its IUPAC name is 5-chloro-6-methyl-2-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-methyl-2-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 30772169 |
| Molecular Formula | C8H4ClF3N2O |
| Molecular Weight | 236.58 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 5-chloro-6-methyl-2-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile |
| SMILES | Cc1[nH]c(=O)c(C#N)c(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H4ClF3N2O/c1-3-6(9)5(8(10,11)12)4(2-13)7(15)14-3/h1H3,(H,14,15) |
| InChIKey | ASIAROODYAVYRI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |