C11H14N6S2 — CID 3078954
2-[3-(4-aminopyrimidin-2-yl)sulfanylpropylsulfanyl]pyrimidin-4-amine (PubChem CID 3078954) has the molecular formula C11H14N6S2 and a molecular weight of 294.41 g/mol. Its IUPAC name is 2-[3-(4-aminopyrimidin-2-yl)sulfanylpropylsulfanyl]pyrimidin-4-amine.
| Compound Name | 2-[3-(4-aminopyrimidin-2-yl)sulfanylpropylsulfanyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 3078954 |
| Molecular Formula | C11H14N6S2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[3-(4-aminopyrimidin-2-yl)sulfanylpropylsulfanyl]pyrimidin-4-amine |
| SMILES | Nc1ccnc(SCCCSc2nccc(N)n2)n1 |
| InChI | InChI=1S/C11H14N6S2/c12-8-2-4-14-10(16-8)18-6-1-7-19-11-15-5-3-9(13)17-11/h2-5H,1,6-7H2,(H2,12,14,16)(H2,13,15,17) |
| InChIKey | VKOJMFASCCFCKW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|