C14H22N8S2 — CID 13285556
2-[6-(4,6-diaminopyrimidin-2-yl)sulfanylhexylsulfanyl]pyrimidine-4,6-diamine (PubChem CID 13285556) has the molecular formula C14H22N8S2 and a molecular weight of 366.52 g/mol. Its IUPAC name is 2-[6-(4,6-diaminopyrimidin-2-yl)sulfanylhexylsulfanyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[6-(4,6-diaminopyrimidin-2-yl)sulfanylhexylsulfanyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 13285556 |
| Molecular Formula | C14H22N8S2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[6-(4,6-diaminopyrimidin-2-yl)sulfanylhexylsulfanyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCCCCCCSc2nc(N)cc(N)n2)n1 |
| InChI | InChI=1S/C14H22N8S2/c15-9-7-10(16)20-13(19-9)23-5-3-1-2-4-6-24-14-21-11(17)8-12(18)22-14/h7-8H,1-6H2,(H4,15,16,19,20)(H4,17,18,21,22) |
| InChIKey | YNLRQISPELDUTM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|