C22H21NO7 — CID 30792260
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 30792260) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 30792260 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)CCN2C(=O)c3ccc(C)cc3C2=O)c1 |
| InChI | InChI=1S/C22H21NO7/c1-13-4-6-15-16(10-13)22(27)23(21(15)26)9-8-20(25)30-12-18(24)17-11-14(28-2)5-7-19(17)29-3/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | CUVJJZBJXNZOOH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|