C18H13ClN4O2S — CID 3079568
5-chloro-N-(4-oxo-2-phenylimino-1,3-thiazolidin-3-yl)-1H-indole-2-carboxamide (PubChem CID 3079568) has the molecular formula C18H13ClN4O2S and a molecular weight of 384.85 g/mol. Its IUPAC name is 5-chloro-N-(4-oxo-2-phenylimino-1,3-thiazolidin-3-yl)-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-(4-oxo-2-phenylimino-1,3-thiazolidin-3-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 3079568 |
| Molecular Formula | C18H13ClN4O2S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 5-chloro-N-(4-oxo-2-phenylimino-1,3-thiazolidin-3-yl)-1H-indole-2-carboxamide |
| SMILES | O=C(NN1C(=O)CS/C1=N\c1ccccc1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C18H13ClN4O2S/c19-12-6-7-14-11(8-12)9-15(21-14)17(25)22-23-16(24)10-26-18(23)20-13-4-2-1-3-5-13/h1-9,21H,10H2,(H,22,25)/b20-18- |
| InChIKey | RTABUESMAUQUPI-ZZEZOPTASA-N |
| XLogP | 3.73 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|