C22H20N2O4 — CID 30804525
N-[3-(cyclopropanecarbonylamino)phenyl]-3-(phenoxymethyl)furan-2-carboxamide (PubChem CID 30804525) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)phenyl]-3-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)phenyl]-3-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 30804525 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)phenyl]-3-(phenoxymethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2CC2)c1)c1occc1COc1ccccc1 |
| InChI | InChI=1S/C22H20N2O4/c25-21(15-9-10-15)23-17-5-4-6-18(13-17)24-22(26)20-16(11-12-27-20)14-28-19-7-2-1-3-8-19/h1-8,11-13,15H,9-10,14H2,(H,23,25)(H,24,26) |
| InChIKey | NFLTXERTDWRFIG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |