C24H20N2O4 — CID 38668380
3-(phenoxymethyl)-N-[3-(pyridin-2-ylmethoxy)phenyl]furan-2-carboxamide (PubChem CID 38668380) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-(phenoxymethyl)-N-[3-(pyridin-2-ylmethoxy)phenyl]furan-2-carboxamide.
| Compound Name | 3-(phenoxymethyl)-N-[3-(pyridin-2-ylmethoxy)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 38668380 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-(phenoxymethyl)-N-[3-(pyridin-2-ylmethoxy)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(OCc2ccccn2)c1)c1occc1COc1ccccc1 |
| InChI | InChI=1S/C24H20N2O4/c27-24(23-18(12-14-28-23)16-29-21-9-2-1-3-10-21)26-19-8-6-11-22(15-19)30-17-20-7-4-5-13-25-20/h1-15H,16-17H2,(H,26,27) |
| InChIKey | XKOPBXPMRRCJKM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |