C22H21FN4O3 — CID 30804576
N-[2-fluoro-5-[4-(4-oxoquinazolin-3-yl)butanoylamino]phenyl]cyclopropanecarboxamide (PubChem CID 30804576) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is N-[2-fluoro-5-[4-(4-oxoquinazolin-3-yl)butanoylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[2-fluoro-5-[4-(4-oxoquinazolin-3-yl)butanoylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 30804576 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[2-fluoro-5-[4-(4-oxoquinazolin-3-yl)butanoylamino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(CCCn1cnc2ccccc2c1=O)Nc1ccc(F)c(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C22H21FN4O3/c23-17-10-9-15(12-19(17)26-21(29)14-7-8-14)25-20(28)6-3-11-27-13-24-18-5-2-1-4-16(18)22(27)30/h1-2,4-5,9-10,12-14H,3,6-8,11H2,(H,25,28)(H,26,29) |
| InChIKey | SCEAHCYOLQTHQF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |