C10H14N4O2 — CID 3082188
4-N,5-N-dimethyl-1-prop-2-enylpyrazole-4,5-dicarboxamide (PubChem CID 3082188) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 4-N,5-N-dimethyl-1-prop-2-enylpyrazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-dimethyl-1-prop-2-enylpyrazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 3082188 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 4-N,5-N-dimethyl-1-prop-2-enylpyrazole-4,5-dicarboxamide |
| SMILES | C=CCn1ncc(C(=O)NC)c1C(=O)NC |
| InChI | InChI=1S/C10H14N4O2/c1-4-5-14-8(10(16)12-3)7(6-13-14)9(15)11-2/h4,6H,1,5H2,2-3H3,(H,11,15)(H,12,16) |
| InChIKey | KQEFVFVNXVZUSC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|