C14H11F3N6O3 — CID 30822850
(1R)-1-(4-nitrophenyl)-2-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethanol (PubChem CID 30822850) has the molecular formula C14H11F3N6O3 and a molecular weight of 368.28 g/mol. Its IUPAC name is (1R)-1-(4-nitrophenyl)-2-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethanol.
| Compound Name | (1R)-1-(4-nitrophenyl)-2-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 30822850 |
| Molecular Formula | C14H11F3N6O3 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (1R)-1-(4-nitrophenyl)-2-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]ethanol |
| SMILES | O=[N+]([O-])c1ccc([C@@H](O)CNc2ccc3nnc(C(F)(F)F)n3n2)cc1 |
| InChI | InChI=1S/C14H11F3N6O3/c15-14(16,17)13-20-19-12-6-5-11(21-22(12)13)18-7-10(24)8-1-3-9(4-2-8)23(25)26/h1-6,10,24H,7H2,(H,18,21)/t10-/m0/s1 |
| InChIKey | JVCPUBDCNSLDEN-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|