C16H21N3O5S2 — CID 30830987
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[5-(dimethylsulfamoyl)-2-hydroxyphenyl]acetamide (PubChem CID 30830987) has the molecular formula C16H21N3O5S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[5-(dimethylsulfamoyl)-2-hydroxyphenyl]acetamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[5-(dimethylsulfamoyl)-2-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 30830987 |
| Molecular Formula | C16H21N3O5S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[5-(dimethylsulfamoyl)-2-hydroxyphenyl]acetamide |
| SMILES | Cc1noc(C)c1CSCC(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1O |
| InChI | InChI=1S/C16H21N3O5S2/c1-10-13(11(2)24-18-10)8-25-9-16(21)17-14-7-12(5-6-15(14)20)26(22,23)19(3)4/h5-7,20H,8-9H2,1-4H3,(H,17,21) |
| InChIKey | WVEBCXVANHTTHK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|