C21H27N3OS — CID 30852132
2-[(2S)-4-[(1-methylindol-3-yl)methyl]-1-(thiophen-3-ylmethyl)piperazin-2-yl]ethanol (PubChem CID 30852132) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-[(2S)-4-[(1-methylindol-3-yl)methyl]-1-(thiophen-3-ylmethyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-[(1-methylindol-3-yl)methyl]-1-(thiophen-3-ylmethyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 30852132 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[(2S)-4-[(1-methylindol-3-yl)methyl]-1-(thiophen-3-ylmethyl)piperazin-2-yl]ethanol |
| SMILES | Cn1cc(CN2CCN(Cc3ccsc3)[C@@H](CCO)C2)c2ccccc21 |
| InChI | InChI=1S/C21H27N3OS/c1-22-13-18(20-4-2-3-5-21(20)22)14-23-8-9-24(19(15-23)6-10-25)12-17-7-11-26-16-17/h2-5,7,11,13,16,19,25H,6,8-10,12,14-15H2,1H3/t19-/m0/s1 |
| InChIKey | FSLMLNWLHZLVRG-IBGZPJMESA-N |
| XLogP | 3.31 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |