C18H23ClN2O2S — CID 45187791
4-chloro-2-[[3-(2-hydroxyethyl)-4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]phenol (PubChem CID 45187791) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is 4-chloro-2-[[3-(2-hydroxyethyl)-4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]phenol.
| Compound Name | 4-chloro-2-[[3-(2-hydroxyethyl)-4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 45187791 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-chloro-2-[[3-(2-hydroxyethyl)-4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]phenol |
| SMILES | OCCC1CN(Cc2cc(Cl)ccc2O)CCN1Cc1ccsc1 |
| InChI | InChI=1S/C18H23ClN2O2S/c19-16-1-2-18(23)15(9-16)11-20-5-6-21(17(12-20)3-7-22)10-14-4-8-24-13-14/h1-2,4,8-9,13,17,22-23H,3,5-7,10-12H2 |
| InChIKey | KWGFZTLZRRXPQM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|