C19H29ClN2O2 — CID 45204573
4-chloro-2-[[4-cyclohexyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]phenol (PubChem CID 45204573) has the molecular formula C19H29ClN2O2 and a molecular weight of 352.91 g/mol. Its IUPAC name is 4-chloro-2-[[4-cyclohexyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]phenol.
| Compound Name | 4-chloro-2-[[4-cyclohexyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 45204573 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 4-chloro-2-[[4-cyclohexyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]phenol |
| SMILES | OCCC1CN(Cc2cc(Cl)ccc2O)CCN1C1CCCCC1 |
| InChI | InChI=1S/C19H29ClN2O2/c20-16-6-7-19(24)15(12-16)13-21-9-10-22(18(14-21)8-11-23)17-4-2-1-3-5-17/h6-7,12,17-18,23-24H,1-5,8-11,13-14H2 |
| InChIKey | JYWQRGRLPJNWIX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|