C18H25F3N2O — CID 45212647
2-[1-cyclopentyl-4-[(2,3,6-trifluorophenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 45212647) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is 2-[1-cyclopentyl-4-[(2,3,6-trifluorophenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[1-cyclopentyl-4-[(2,3,6-trifluorophenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45212647 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[1-cyclopentyl-4-[(2,3,6-trifluorophenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | OCCC1CN(Cc2c(F)ccc(F)c2F)CCN1C1CCCC1 |
| InChI | InChI=1S/C18H25F3N2O/c19-16-5-6-17(20)18(21)15(16)12-22-8-9-23(13-3-1-2-4-13)14(11-22)7-10-24/h5-6,13-14,24H,1-4,7-12H2 |
| InChIKey | VYNIXHYYOWOCKZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|