C15H20N2O2S2 — CID 30854296
2-butylsulfanyl-N-[[5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide (PubChem CID 30854296) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[[5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide.
| Compound Name | 2-butylsulfanyl-N-[[5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 30854296 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-butylsulfanyl-N-[[5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide |
| SMILES | CCCCSCC(=O)NCc1ccc(-c2csc(C)n2)o1 |
| InChI | InChI=1S/C15H20N2O2S2/c1-3-4-7-20-10-15(18)16-8-12-5-6-14(19-12)13-9-21-11(2)17-13/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,16,18) |
| InChIKey | JQZMLAPWPDHFLI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|