C11H16N2O3S2 — CID 66381427
2-[[(2-butylsulfanylacetyl)amino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66381427) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[[(2-butylsulfanylacetyl)amino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[(2-butylsulfanylacetyl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66381427 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-[[(2-butylsulfanylacetyl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCSCC(=O)NCc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-2-3-4-17-7-9(14)12-5-10-13-8(6-18-10)11(15)16/h6H,2-5,7H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | DEEULSHOXTUPHN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|