C23H46NO3P — CID 3085466
5,5-dimethyl-N-octadec-9-enyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-amine (PubChem CID 3085466) has the molecular formula C23H46NO3P and a molecular weight of 415.60 g/mol. Its IUPAC name is 5,5-dimethyl-N-octadec-9-enyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-amine.
| Compound Name | 5,5-dimethyl-N-octadec-9-enyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 3085466 |
| Molecular Formula | C23H46NO3P |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | 5,5-dimethyl-N-octadec-9-enyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-amine |
| SMILES | CCCCCCCCC=CCCCCCCCCNP1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C23H46NO3P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-28(25)26-21-23(2,3)22-27-28/h11-12H,4-10,13-22H2,1-3H3,(H,24,25) |
| InChIKey | GUNVBLROSRGRAL-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|