C13H13N5O — CID 30865225
2-(2-methylindol-1-yl)-N-(1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 30865225) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(2-methylindol-1-yl)-N-(1H-1,2,4-triazol-5-yl)acetamide.
| Compound Name | 2-(2-methylindol-1-yl)-N-(1H-1,2,4-triazol-5-yl)acetamide |
|---|---|
| PubChem CID | 30865225 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-(2-methylindol-1-yl)-N-(1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C13H13N5O/c1-9-6-10-4-2-3-5-11(10)18(9)7-12(19)16-13-14-8-15-17-13/h2-6,8H,7H2,1H3,(H2,14,15,16,17,19) |
| InChIKey | AHAKGOZADHYSPE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |