C14H15N5O — CID 60981974
2-(2-methylindol-1-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide (PubChem CID 60981974) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-(2-methylindol-1-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide.
| Compound Name | 2-(2-methylindol-1-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 60981974 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(2-methylindol-1-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C14H15N5O/c1-10-6-11-4-2-3-5-12(11)19(10)8-14(20)15-7-13-16-9-17-18-13/h2-6,9H,7-8H2,1H3,(H,15,20)(H,16,17,18) |
| InChIKey | WEKFBWQUMNWDOS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |