C16H15BrN2OS — CID 55801706
N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylindol-1-yl)acetamide (PubChem CID 55801706) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylindol-1-yl)acetamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 55801706 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylindol-1-yl)acetamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C16H15BrN2OS/c1-11-6-12-4-2-3-5-15(12)19(11)9-16(20)18-8-14-7-13(17)10-21-14/h2-7,10H,8-9H2,1H3,(H,18,20) |
| InChIKey | OEIMDRUAFZASNL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |