C16H21N5O4S2 — CID 30865349
2-[[5-[4-(furan-2-carbonyl)piperazin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 30865349) has the molecular formula C16H21N5O4S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-[[5-[4-(furan-2-carbonyl)piperazin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[5-[4-(furan-2-carbonyl)piperazin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 30865349 |
| Molecular Formula | C16H21N5O4S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-[[5-[4-(furan-2-carbonyl)piperazin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1nnc(N2CCN(C(=O)c3ccco3)CC2)s1 |
| InChI | InChI=1S/C16H21N5O4S2/c1-24-10-4-17-13(22)11-26-16-19-18-15(27-16)21-7-5-20(6-8-21)14(23)12-3-2-9-25-12/h2-3,9H,4-8,10-11H2,1H3,(H,17,22) |
| InChIKey | WIOFIHVAVIOTFO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|