C12H13Cl2NO4S — CID 3086688
1-(3,4-dichlorophenyl)sulfonyl-5-ethoxypyrrolidin-2-one (PubChem CID 3086688) has the molecular formula C12H13Cl2NO4S and a molecular weight of 338.21 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)sulfonyl-5-ethoxypyrrolidin-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)sulfonyl-5-ethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 3086688 |
| Molecular Formula | C12H13Cl2NO4S |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)sulfonyl-5-ethoxypyrrolidin-2-one |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO4S/c1-2-19-12-6-5-11(16)15(12)20(17,18)8-3-4-9(13)10(14)7-8/h3-4,7,12H,2,5-6H2,1H3 |
| InChIKey | MCGKUICRVXYIEI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |