C9H9N3O2 — CID 3086912
1,3-dimethylpyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 3086912) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1,3-dimethylpyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethylpyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3086912 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 1,3-dimethylpyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2cnccc2n(C)c1=O |
| InChI | InChI=1S/C9H9N3O2/c1-11-7-3-4-10-5-6(7)8(13)12(2)9(11)14/h3-5H,1-2H3 |
| InChIKey | GXLUIUJUEVVCKL-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |