C16H29N5O — CID 30869809
N-[[(2R)-oxolan-2-yl]methyl]-N-[[1-(piperidin-4-ylmethyl)triazol-4-yl]methyl]ethanamine (PubChem CID 30869809) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-N-[[1-(piperidin-4-ylmethyl)triazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-N-[[1-(piperidin-4-ylmethyl)triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 30869809 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-N-[[1-(piperidin-4-ylmethyl)triazol-4-yl]methyl]ethanamine |
| SMILES | CCN(Cc1cn(CC2CCNCC2)nn1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C16H29N5O/c1-2-20(13-16-4-3-9-22-16)11-15-12-21(19-18-15)10-14-5-7-17-8-6-14/h12,14,16-17H,2-11,13H2,1H3/t16-/m1/s1 |
| InChIKey | MGOXPUVMHUBTMN-MRXNPFEDSA-N |
| XLogP | 1.28 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |