C19H20N4O4S — CID 30870727
4-(diethylsulfamoyl)-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]benzamide (PubChem CID 30870727) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 30870727 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2cccc(-c3nnco3)c2)cc1 |
| InChI | InChI=1S/C19H20N4O4S/c1-3-23(4-2)28(25,26)17-10-8-14(9-11-17)18(24)21-16-7-5-6-15(12-16)19-22-20-13-27-19/h5-13H,3-4H2,1-2H3,(H,21,24) |
| InChIKey | MYAWKXOGTAOMKE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |