C16H16N4O5S — CID 30870970
N-(4-ethyl-3-nitrophenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 30870970) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is N-(4-ethyl-3-nitrophenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-(4-ethyl-3-nitrophenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 30870970 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-(4-ethyl-3-nitrophenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N4O5S/c1-2-11-3-5-13(9-14(11)20(22)23)17-16(21)12-4-6-15-18-26(24,25)8-7-19(15)10-12/h3-6,9-10H,2,7-8H2,1H3,(H,17,21) |
| InChIKey | OCPPDENDYMPFHF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|