C8H5N3O2S2 — CID 3087134
3-pyrazol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide (PubChem CID 3087134) has the molecular formula C8H5N3O2S2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-pyrazol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide.
| Compound Name | 3-pyrazol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 3087134 |
| Molecular Formula | C8H5N3O2S2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | 3-pyrazol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(n2cccn2)c2sccc21 |
| InChI | InChI=1S/C8H5N3O2S2/c12-15(13)6-2-5-14-7(6)8(10-15)11-4-1-3-9-11/h1-5H |
| InChIKey | BEMFASLOMFLVJC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |