C21H22N4O4S3 — CID 30874619
N-[4-[5-(acetamidomethyl)thiophen-2-yl]-5-methyl-1,3-thiazol-2-yl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 30874619) has the molecular formula C21H22N4O4S3 and a molecular weight of 490.63 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)thiophen-2-yl]-5-methyl-1,3-thiazol-2-yl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[4-[5-(acetamidomethyl)thiophen-2-yl]-5-methyl-1,3-thiazol-2-yl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 30874619 |
| Molecular Formula | C21H22N4O4S3 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)thiophen-2-yl]-5-methyl-1,3-thiazol-2-yl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)Nc2nc(-c3ccc(CNC(C)=O)s3)c(C)s2)c1 |
| InChI | InChI=1S/C21H22N4O4S3/c1-4-10-23-32(28,29)17-7-5-6-15(11-17)20(27)25-21-24-19(13(2)30-21)18-9-8-16(31-18)12-22-14(3)26/h4-9,11,23H,1,10,12H2,2-3H3,(H,22,26)(H,24,25,27) |
| InChIKey | CUDIWLNCJIZFOR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|