C19H26N2O6S — CID 30875793
methyl 2-[[1-(4-acetylphenyl)sulfonylpiperidine-4-carbonyl]amino]-2-methylpropanoate (PubChem CID 30875793) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is methyl 2-[[1-(4-acetylphenyl)sulfonylpiperidine-4-carbonyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[1-(4-acetylphenyl)sulfonylpiperidine-4-carbonyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 30875793 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | methyl 2-[[1-(4-acetylphenyl)sulfonylpiperidine-4-carbonyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)C1CCN(S(=O)(=O)c2ccc(C(C)=O)cc2)CC1 |
| InChI | InChI=1S/C19H26N2O6S/c1-13(22)14-5-7-16(8-6-14)28(25,26)21-11-9-15(10-12-21)17(23)20-19(2,3)18(24)27-4/h5-8,15H,9-12H2,1-4H3,(H,20,23) |
| InChIKey | YQCOJDAULZLJDJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |