C14H23N7 — CID 30876971
N-methyl-1-(1-methylpyrazol-4-yl)-N-[(1-piperidin-4-yltriazol-4-yl)methyl]methanamine (PubChem CID 30876971) has the molecular formula C14H23N7 and a molecular weight of 289.39 g/mol. Its IUPAC name is N-methyl-1-(1-methylpyrazol-4-yl)-N-[(1-piperidin-4-yltriazol-4-yl)methyl]methanamine.
| Compound Name | N-methyl-1-(1-methylpyrazol-4-yl)-N-[(1-piperidin-4-yltriazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 30876971 |
| Molecular Formula | C14H23N7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-methyl-1-(1-methylpyrazol-4-yl)-N-[(1-piperidin-4-yltriazol-4-yl)methyl]methanamine |
| SMILES | CN(Cc1cnn(C)c1)Cc1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C14H23N7/c1-19(8-12-7-16-20(2)9-12)10-13-11-21(18-17-13)14-3-5-15-6-4-14/h7,9,11,14-15H,3-6,8,10H2,1-2H3 |
| InChIKey | AAENCDCZTCGMCF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |