C18H26N6OS — CID 30881963
N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4-(pyridin-4-ylmethyl)piperazine-1-carboxamide (PubChem CID 30881963) has the molecular formula C18H26N6OS and a molecular weight of 374.51 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4-(pyridin-4-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4-(pyridin-4-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 30881963 |
| Molecular Formula | C18H26N6OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4-(pyridin-4-ylmethyl)piperazine-1-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)N2CCN(Cc3ccncc3)CC2)s1 |
| InChI | InChI=1S/C18H26N6OS/c1-2-3-4-5-16-21-22-17(26-16)20-18(25)24-12-10-23(11-13-24)14-15-6-8-19-9-7-15/h6-9H,2-5,10-14H2,1H3,(H,20,22,25) |
| InChIKey | FWRRYLGCUAZAJX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|