C30H25IN4O2S — CID 3088586
1-[4-[6-iodo-2-[(4-methylphenoxy)methyl]-4-oxoquinazolin-3-yl]phenyl]-3-(4-methylphenyl)thiourea (PubChem CID 3088586) has the molecular formula C30H25IN4O2S and a molecular weight of 632.53 g/mol. Its IUPAC name is 1-[4-[6-iodo-2-[(4-methylphenoxy)methyl]-4-oxoquinazolin-3-yl]phenyl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[4-[6-iodo-2-[(4-methylphenoxy)methyl]-4-oxoquinazolin-3-yl]phenyl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 3088586 |
| Molecular Formula | C30H25IN4O2S |
| Molecular Weight | 632.53 g/mol |
| Exact Mass | 632.07 |
| IUPAC Name | 1-[4-[6-iodo-2-[(4-methylphenoxy)methyl]-4-oxoquinazolin-3-yl]phenyl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(-n3c(COc4ccc(C)cc4)nc4ccc(I)cc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C30H25IN4O2S/c1-19-3-8-22(9-4-19)32-30(38)33-23-10-12-24(13-11-23)35-28(18-37-25-14-5-20(2)6-15-25)34-27-16-7-21(31)17-26(27)29(35)36/h3-17H,18H2,1-2H3,(H2,32,33,38) |
| InChIKey | QKISIYGCOXRJSZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|