C17H14IN5OS — CID 46855741
1-[(E)-(6-iodo-4-oxo-3-phenylquinazolin-2-yl)methylideneamino]-3-methylthiourea (PubChem CID 46855741) has the molecular formula C17H14IN5OS and a molecular weight of 463.30 g/mol. Its IUPAC name is 1-[(E)-(6-iodo-4-oxo-3-phenylquinazolin-2-yl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-(6-iodo-4-oxo-3-phenylquinazolin-2-yl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 46855741 |
| Molecular Formula | C17H14IN5OS |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 1-[(E)-(6-iodo-4-oxo-3-phenylquinazolin-2-yl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/c1nc2ccc(I)cc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C17H14IN5OS/c1-19-17(25)22-20-10-15-21-14-8-7-11(18)9-13(14)16(24)23(15)12-5-3-2-4-6-12/h2-10H,1H3,(H2,19,22,25)/b20-10+ |
| InChIKey | FWWIXZNNVHZXIC-KEBDBYFISA-N |
| XLogP | 2.42 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|