C15H23N7S — CID 30897109
[1-[1-[(2-ethylsulfanylpyrimidin-5-yl)methyl]piperidin-4-yl]triazol-4-yl]methanamine (PubChem CID 30897109) has the molecular formula C15H23N7S and a molecular weight of 333.47 g/mol. Its IUPAC name is [1-[1-[(2-ethylsulfanylpyrimidin-5-yl)methyl]piperidin-4-yl]triazol-4-yl]methanamine.
| Compound Name | [1-[1-[(2-ethylsulfanylpyrimidin-5-yl)methyl]piperidin-4-yl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 30897109 |
| Molecular Formula | C15H23N7S |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [1-[1-[(2-ethylsulfanylpyrimidin-5-yl)methyl]piperidin-4-yl]triazol-4-yl]methanamine |
| SMILES | CCSc1ncc(CN2CCC(n3cc(CN)nn3)CC2)cn1 |
| InChI | InChI=1S/C15H23N7S/c1-2-23-15-17-8-12(9-18-15)10-21-5-3-14(4-6-21)22-11-13(7-16)19-20-22/h8-9,11,14H,2-7,10,16H2,1H3 |
| InChIKey | ZFHRZEQKLJBHBJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |