C16H18N2OS2 — CID 30898769
N-(2-pyrrolidin-1-ylphenyl)-2-thiophen-2-ylsulfanylacetamide (PubChem CID 30898769) has the molecular formula C16H18N2OS2 and a molecular weight of 318.47 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylphenyl)-2-thiophen-2-ylsulfanylacetamide.
| Compound Name | N-(2-pyrrolidin-1-ylphenyl)-2-thiophen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 30898769 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-(2-pyrrolidin-1-ylphenyl)-2-thiophen-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1cccs1)Nc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C16H18N2OS2/c19-15(12-21-16-8-5-11-20-16)17-13-6-1-2-7-14(13)18-9-3-4-10-18/h1-2,5-8,11H,3-4,9-10,12H2,(H,17,19) |
| InChIKey | FYYBUILDOANBPE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |