C13H11NO4S2 — CID 104832830
2-hydroxy-3-[(2-thiophen-2-ylsulfanylacetyl)amino]benzoic acid (PubChem CID 104832830) has the molecular formula C13H11NO4S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-thiophen-2-ylsulfanylacetyl)amino]benzoic acid.
| Compound Name | 2-hydroxy-3-[(2-thiophen-2-ylsulfanylacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 104832830 |
| Molecular Formula | C13H11NO4S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 2-hydroxy-3-[(2-thiophen-2-ylsulfanylacetyl)amino]benzoic acid |
| SMILES | O=C(CSc1cccs1)Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C13H11NO4S2/c15-10(7-20-11-5-2-6-19-11)14-9-4-1-3-8(12(9)16)13(17)18/h1-6,16H,7H2,(H,14,15)(H,17,18) |
| InChIKey | UKFZEVQMFNPWMD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|