C19H20N2O3 — CID 3092293
(5,5-dimethyl-3-oxido-2,4-diphenyl-2H-imidazol-3-ium-1-yl) acetate (PubChem CID 3092293) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (5,5-dimethyl-3-oxido-2,4-diphenyl-2H-imidazol-3-ium-1-yl) acetate.
| Compound Name | (5,5-dimethyl-3-oxido-2,4-diphenyl-2H-imidazol-3-ium-1-yl) acetate |
|---|---|
| PubChem CID | 3092293 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (5,5-dimethyl-3-oxido-2,4-diphenyl-2H-imidazol-3-ium-1-yl) acetate |
| SMILES | CC(=O)ON1C(c2ccccc2)[N+]([O-])=C(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C19H20N2O3/c1-14(22)24-21-18(16-12-8-5-9-13-16)20(23)17(19(21,2)3)15-10-6-4-7-11-15/h4-13,18H,1-3H3 |
| InChIKey | ZRAMCYVRXQQHPT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|