C29H27ClN4O2 — CID 30935960
3-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-6-(4-chlorophenyl)pyrimidin-4-one (PubChem CID 30935960) has the molecular formula C29H27ClN4O2 and a molecular weight of 499.01 g/mol. Its IUPAC name is 3-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-6-(4-chlorophenyl)pyrimidin-4-one.
| Compound Name | 3-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-6-(4-chlorophenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 30935960 |
| Molecular Formula | C29H27ClN4O2 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 3-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-6-(4-chlorophenyl)pyrimidin-4-one |
| SMILES | O=C(Cn1cnc(-c2ccc(Cl)cc2)cc1=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H27ClN4O2/c30-25-13-11-22(12-14-25)26-19-27(35)34(21-31-26)20-28(36)32-15-17-33(18-16-32)29(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-14,19,21,29H,15-18,20H2 |
| InChIKey | XKQGGHLIVFDYMI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |